C13H23N3O2S2 — CID 59409578
(3R,7R,11E)-3-(2-aminoacetyl)-7-(methylamino)-1,9-dithia-4-azacyclotridec-11-en-6-one (PubChem CID 59409578) has the molecular formula C13H23N3O2S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is (3R,7R,11E)-3-(2-aminoacetyl)-7-(methylamino)-1,9-dithia-4-azacyclotridec-11-en-6-one.
| Compound Name | (3R,7R,11E)-3-(2-aminoacetyl)-7-(methylamino)-1,9-dithia-4-azacyclotridec-11-en-6-one |
|---|---|
| PubChem CID | 59409578 |
| Molecular Formula | C13H23N3O2S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3R,7R,11E)-3-(2-aminoacetyl)-7-(methylamino)-1,9-dithia-4-azacyclotridec-11-en-6-one |
| SMILES | CN[C@H]1CSC/C=C/CSC[C@@H](C(=O)CN)NCC1=O |
| InChI | InChI=1S/C13H23N3O2S2/c1-15-10-8-19-4-2-3-5-20-9-11(12(17)6-14)16-7-13(10)18/h2-3,10-11,15-16H,4-9,14H2,1H3/b3-2+/t10-,11-/m0/s1 |
| InChIKey | XWTLDWGMBGOOCZ-ZNRGBCAMSA-N |
| XLogP | -0.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|