About (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one
(4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one (PubChem CID 59409604) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one.
Molecular Properties
| Compound Name | (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one |
| PubChem CID | 59409604 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one |
| SMILES | CC(C)=CCCC[C@@](C)(NC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C16H31NO/c1-12(2)10-8-9-11-16(7,17-14(5)6)15(18)13(3)4/h10,13-14,17H,8-9,11H2,1-7H3/t16-/m1/s1 |
| InChIKey | VETXDZNRZDOUIC-MRXNPFEDSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one?
The IUPAC name of (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one (CID 59409604) is (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one.
What is the SMILES notation for (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one?
The canonical SMILES for (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one is CC(C)=CCCC[C@@](C)(NC(C)C)C(=O)C(C)C.
What is the InChIKey of (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one?
The InChIKey is VETXDZNRZDOUIC-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H31NO/c1-12(2)10-8-9-11-16(7,17-14(5)6)15(18)13(3)4/h10,13-14,17H,8-9,11H2,1-7H3/t16-/m1/s1.
What are the key properties of (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one?
(4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one has a molecular weight of 253.43 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,4,9-trimethyl-4-(propan-2-ylamino)dec-8-en-3-one is sourced from PubChem (CID 59409604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).