About (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one
(4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one (PubChem CID 59409624) has the molecular formula C19H37NO
and a molecular weight of 295.51 g/mol. Its IUPAC name is (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one.
Molecular Properties
| Compound Name | (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one |
| PubChem CID | 59409624 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one |
| SMILES | CC(C)=CCCCCCC[C@](C)(NC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C19H37NO/c1-15(2)13-11-9-8-10-12-14-19(7,20-17(5)6)18(21)16(3)4/h13,16-17,20H,8-12,14H2,1-7H3/t19-/m0/s1 |
| InChIKey | CUNABVIEVZWLOU-IBGZPJMESA-N |
| XLogP | 5.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one?
The IUPAC name of (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one (CID 59409624) is (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one.
What is the SMILES notation for (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one?
The canonical SMILES for (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one is CC(C)=CCCCCCC[C@](C)(NC(C)C)C(=O)C(C)C.
What is the InChIKey of (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one?
The InChIKey is CUNABVIEVZWLOU-IBGZPJMESA-N. The full InChI is InChI=1S/C19H37NO/c1-15(2)13-11-9-8-10-12-14-19(7,20-17(5)6)18(21)16(3)4/h13,16-17,20H,8-12,14H2,1-7H3/t19-/m0/s1.
What are the key properties of (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one?
(4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one has a molecular weight of 295.51 g/mol, XLogP of 5.28, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4,12-trimethyl-4-(propan-2-ylamino)tridec-11-en-3-one is sourced from PubChem (CID 59409624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).