C38H49N3O7S — CID 59409979
(2R)-3-[1-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoic acid (PubChem CID 59409979) has the molecular formula C38H49N3O7S and a molecular weight of 691.89 g/mol. Its IUPAC name is (2R)-3-[1-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoic acid.
| Compound Name | (2R)-3-[1-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 59409979 |
| Molecular Formula | C38H49N3O7S |
| Molecular Weight | 691.89 g/mol |
| Exact Mass | 691.33 |
| IUPAC Name | (2R)-3-[1-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCN1C(=O)CC(SC[C@H](NC(=O)c2ccccc2O)C(=O)O)C1=O |
| InChI | InChI=1S/C38H49N3O7S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-34(43)39-26-27-41-35(44)28-33(37(41)46)49-29-31(38(47)48)40-36(45)30-23-21-22-24-32(30)42/h3-4,6-7,9-10,12-13,15-16,18-19,21-24,31,33,42H,2,5,8,11,14,17,20,25-29H2,1H3,(H,39,43)(H,40,45)(H,47,48)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/t31-,33?/m0/s1 |
| InChIKey | KVFPHAKGPZUGFX-RLPHMSGRSA-N |
| XLogP | 6.03 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.89 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|