C23H29N3O7S — CID 59409987
methyl 3-[1-[2-[[(Z)-hex-3-enoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoate (PubChem CID 59409987) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is methyl 3-[1-[2-[[(Z)-hex-3-enoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoate.
| Compound Name | methyl 3-[1-[2-[[(Z)-hex-3-enoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 59409987 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | methyl 3-[1-[2-[[(Z)-hex-3-enoyl]amino]ethyl]-2,5-dioxopyrrolidin-3-yl]sulfanyl-2-[(2-hydroxybenzoyl)amino]propanoate |
| SMILES | CC/C=C\CC(=O)NCCN1C(=O)CC(SCC(NC(=O)c2ccccc2O)C(=O)OC)C1=O |
| InChI | InChI=1S/C23H29N3O7S/c1-3-4-5-10-19(28)24-11-12-26-20(29)13-18(22(26)31)34-14-16(23(32)33-2)25-21(30)15-8-6-7-9-17(15)27/h4-9,16,18,27H,3,10-14H2,1-2H3,(H,24,28)(H,25,30)/b5-4- |
| InChIKey | GIKQRIKJAWNMMO-PLNGDYQASA-N |
| XLogP | 1.00 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|