About 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine
4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine (PubChem CID 59410517) has the molecular formula C8H3F2N5O3
and a molecular weight of 255.14 g/mol. Its IUPAC name is 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine.
Molecular Properties
| Compound Name | 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
| PubChem CID | 59410517 |
| Molecular Formula | C8H3F2N5O3 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-n1nnnc1C(F)(F)O2 |
| InChI | InChI=1S/C8H3F2N5O3/c9-8(10)7-11-12-13-14(7)5-3-4(15(16)17)1-2-6(5)18-8/h1-3H |
| InChIKey | YGNVZVHUGVJRMF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The IUPAC name of 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine (CID 59410517) is 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine.
What is the SMILES notation for 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The canonical SMILES for 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine is O=[N+]([O-])c1ccc2c(c1)-n1nnnc1C(F)(F)O2.
What is the InChIKey of 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
The InChIKey is YGNVZVHUGVJRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F2N5O3/c9-8(10)7-11-12-13-14(7)5-3-4(15(16)17)1-2-6(5)18-8/h1-3H.
What are the key properties of 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine?
4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine has a molecular weight of 255.14 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-8-nitrotetrazolo[5,1-c][1,4]benzoxazine is sourced from PubChem (CID 59410517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).