About 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine
4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine (PubChem CID 59410522) has the molecular formula C8H5F2N5O
and a molecular weight of 225.16 g/mol. Its IUPAC name is 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine.
Molecular Properties
| Compound Name | 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine |
| PubChem CID | 59410522 |
| Molecular Formula | C8H5F2N5O |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine |
| SMILES | Nc1ccc2c(c1)-n1nnnc1C(F)(F)O2 |
| InChI | InChI=1S/C8H5F2N5O/c9-8(10)7-12-13-14-15(7)5-3-4(11)1-2-6(5)16-8/h1-3H,11H2 |
| InChIKey | XRFRIBMEDBTXHC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The IUPAC name of 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine (CID 59410522) is 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine.
What is the SMILES notation for 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The canonical SMILES for 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine is Nc1ccc2c(c1)-n1nnnc1C(F)(F)O2.
What is the InChIKey of 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The InChIKey is XRFRIBMEDBTXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2N5O/c9-8(10)7-12-13-14-15(7)5-3-4(11)1-2-6(5)16-8/h1-3H,11H2.
What are the key properties of 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine?
4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine has a molecular weight of 225.16 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluorotetrazolo[5,1-c][1,4]benzoxazin-8-amine is sourced from PubChem (CID 59410522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).