About 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine
4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine (PubChem CID 59410530) has the molecular formula C8H7N5O
and a molecular weight of 189.18 g/mol. Its IUPAC name is 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine.
Molecular Properties
| Compound Name | 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine |
| PubChem CID | 59410530 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine |
| SMILES | Nc1ccc2c(c1)-n1nnnc1CO2 |
| InChI | InChI=1S/C8H7N5O/c9-5-1-2-7-6(3-5)13-8(4-14-7)10-11-12-13/h1-3H,4,9H2 |
| InChIKey | LWCDQIOXKXLSOL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The IUPAC name of 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine (CID 59410530) is 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine.
What is the SMILES notation for 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The canonical SMILES for 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine is Nc1ccc2c(c1)-n1nnnc1CO2.
What is the InChIKey of 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine?
The InChIKey is LWCDQIOXKXLSOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O/c9-5-1-2-7-6(3-5)13-8(4-14-7)10-11-12-13/h1-3H,4,9H2.
What are the key properties of 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine?
4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine has a molecular weight of 189.18 g/mol, XLogP of 0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-tetrazolo[5,1-c][1,4]benzoxazin-8-amine is sourced from PubChem (CID 59410530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).