C23H19Cl3N4O4S — CID 59410980
N-[[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]methyl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 59410980) has the molecular formula C23H19Cl3N4O4S and a molecular weight of 553.86 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]methyl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]methyl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 59410980 |
| Molecular Formula | C23H19Cl3N4O4S |
| Molecular Weight | 553.86 g/mol |
| Exact Mass | 552.02 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]methyl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C23H19Cl3N4O4S/c1-14-2-8-19(30(31)32)12-23(14)35(33,34)27-13-18-11-22(15-3-5-16(24)6-4-15)29(28-18)21-9-7-17(25)10-20(21)26/h2-10,12,22,27H,11,13H2,1H3 |
| InChIKey | CFWILEIWDITBBC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|