C15H19F3N2O3 — CID 59411175
methyl (2S)-3-cyclohexyl-2-[2-oxo-5-(trifluoromethyl)pyrazin-1-yl]propanoate (PubChem CID 59411175) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is methyl (2S)-3-cyclohexyl-2-[2-oxo-5-(trifluoromethyl)pyrazin-1-yl]propanoate.
| Compound Name | methyl (2S)-3-cyclohexyl-2-[2-oxo-5-(trifluoromethyl)pyrazin-1-yl]propanoate |
|---|---|
| PubChem CID | 59411175 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | methyl (2S)-3-cyclohexyl-2-[2-oxo-5-(trifluoromethyl)pyrazin-1-yl]propanoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)n1cc(C(F)(F)F)ncc1=O |
| InChI | InChI=1S/C15H19F3N2O3/c1-23-14(22)11(7-10-5-3-2-4-6-10)20-9-12(15(16,17)18)19-8-13(20)21/h8-11H,2-7H2,1H3/t11-/m0/s1 |
| InChIKey | PIOWSKNWSLYPDK-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |