C21H21N3O3S2 — CID 59411578
5-[[4-[2-[1,3-benzothiazol-2-yl(ethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 59411578) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 5-[[4-[2-[1,3-benzothiazol-2-yl(ethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[1,3-benzothiazol-2-yl(ethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59411578 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 5-[[4-[2-[1,3-benzothiazol-2-yl(ethyl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-2-24(20-22-16-5-3-4-6-17(16)28-20)11-12-27-15-9-7-14(8-10-15)13-18-19(25)23-21(26)29-18/h3-10,18H,2,11-13H2,1H3,(H,23,25,26) |
| InChIKey | PUHNCOFJXJNUIS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|