C15H20N4OS — CID 59411605
N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 59411605) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 59411605 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[[(3S,3aS,6aR)-5-methyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | CC1C[C@H]2CN[C@H](CNC(=O)c3cn4ccsc4n3)[C@H]2C1 |
| InChI | InChI=1S/C15H20N4OS/c1-9-4-10-6-16-12(11(10)5-9)7-17-14(20)13-8-19-2-3-21-15(19)18-13/h2-3,8-12,16H,4-7H2,1H3,(H,17,20)/t9?,10-,11-,12+/m0/s1 |
| InChIKey | ADJXCKYUVPWTRR-HSTDOPHLSA-N |
| XLogP | 1.76 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |