C14H18N4OS — CID 59411608
N-[[(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 59411608) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[[(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | N-[[(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59411608 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[[(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | O=C(NC[C@H]1NC[C@@H]2CCC[C@@H]21)c1cnc2sccn12 |
| InChI | InChI=1S/C14H18N4OS/c19-13(12-8-17-14-18(12)4-5-20-14)16-7-11-10-3-1-2-9(10)6-15-11/h4-5,8-11,15H,1-3,6-7H2,(H,16,19)/t9-,10-,11+/m0/s1 |
| InChIKey | HMSBBDYIOJRENS-GARJFASQSA-N |
| XLogP | 1.51 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |