C19H26N4O3S — CID 59411614
tert-butyl (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-5-carbonylamino)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 59411614) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is tert-butyl (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-5-carbonylamino)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-5-carbonylamino)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 59411614 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | tert-butyl (3S,3aS,6aR)-3-[(imidazo[2,1-b][1,3]thiazole-5-carbonylamino)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1CNC(=O)c1cnc2sccn12 |
| InChI | InChI=1S/C19H26N4O3S/c1-19(2,3)26-18(25)23-11-12-5-4-6-13(12)14(23)9-20-16(24)15-10-21-17-22(15)7-8-27-17/h7-8,10,12-14H,4-6,9,11H2,1-3H3,(H,20,24)/t12-,13-,14+/m0/s1 |
| InChIKey | JJZSIORDFIWPSH-MELADBBJSA-N |
| XLogP | 3.16 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |