About 5-methylsulfonyl-2,3-dihydro-1-benzofuran
5-methylsulfonyl-2,3-dihydro-1-benzofuran (PubChem CID 59412097) has the molecular formula C9H10O3S
and a molecular weight of 198.24 g/mol. Its IUPAC name is 5-methylsulfonyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 59412097 |
| Molecular Formula | C9H10O3S |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 5-methylsulfonyl-2,3-dihydro-1-benzofuran |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H10O3S/c1-13(10,11)8-2-3-9-7(6-8)4-5-12-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | MXQUEJBFYKDCAE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylsulfonyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 5-methylsulfonyl-2,3-dihydro-1-benzofuran (CID 59412097) is 5-methylsulfonyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 5-methylsulfonyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 5-methylsulfonyl-2,3-dihydro-1-benzofuran is CS(=O)(=O)c1ccc2c(c1)CCO2.
What is the InChIKey of 5-methylsulfonyl-2,3-dihydro-1-benzofuran?
The InChIKey is MXQUEJBFYKDCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3S/c1-13(10,11)8-2-3-9-7(6-8)4-5-12-9/h2-3,6H,4-5H2,1H3.
What are the key properties of 5-methylsulfonyl-2,3-dihydro-1-benzofuran?
5-methylsulfonyl-2,3-dihydro-1-benzofuran has a molecular weight of 198.24 g/mol, XLogP of 1.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 59412097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).