C31H40ClN5O5S — CID 59412116
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]pyridine-4-carboxamide (PubChem CID 59412116) has the molecular formula C31H40ClN5O5S and a molecular weight of 630.21 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 59412116 |
| Molecular Formula | C31H40ClN5O5S |
| Molecular Weight | 630.21 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-(2-chlorophenyl)-1-oxopropan-2-yl]pyridine-4-carboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@H](Cc1ccccc1Cl)NC(=O)c1ccncc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C31H40ClN5O5S/c1-22(2)20-37(43(41,42)27-12-10-25(33)11-13-27)26(21-38)8-5-6-16-35-31(40)29(19-24-7-3-4-9-28(24)32)36-30(39)23-14-17-34-18-15-23/h3-4,7,9-15,17-18,22,26,29,38H,5-6,8,16,19-21,33H2,1-2H3,(H,35,40)(H,36,39)/t26-,29-/m0/s1 |
| InChIKey | YNQRERPFQBJTHG-WNJJXGMVSA-N |
| XLogP | 3.65 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|