C33H43N5O6S — CID 59412123
methyl N-[(2S)-1-[[6-amino-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-oxohexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 59412123) has the molecular formula C33H43N5O6S and a molecular weight of 637.80 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[6-amino-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-oxohexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[6-amino-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-oxohexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 59412123 |
| Molecular Formula | C33H43N5O6S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | methyl N-[(2S)-1-[[6-amino-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-oxohexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)NCCCCC(C(N)=O)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H43N5O6S/c1-23(2)22-38(45(42,43)27-19-17-26(34)18-20-27)28(31(35)39)16-10-11-21-36-32(40)30(37-33(41)44-3)29(24-12-6-4-7-13-24)25-14-8-5-9-15-25/h4-9,12-15,17-20,23,28-30H,10-11,16,21-22,34H2,1-3H3,(H2,35,39)(H,36,40)(H,37,41)/t28?,30-/m0/s1 |
| InChIKey | MHWPVVNPUFZBSG-TXDWVUBVSA-N |
| XLogP | 3.61 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|