C21H25NO — CID 59412259
trans-(4R,5R)-3-(benzylamino)-4,5-dimethyl-4-phenylcyclohexan-1-one (PubChem CID 59412259) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is trans-(4R,5R)-3-(benzylamino)-4,5-dimethyl-4-phenylcyclohexan-1-one.
| Compound Name | trans-(4R,5R)-3-(benzylamino)-4,5-dimethyl-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 59412259 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | trans-(4R,5R)-3-(benzylamino)-4,5-dimethyl-4-phenylcyclohexan-1-one |
| SMILES | C[C@@H]1CC(=O)CC(NCc2ccccc2)[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-16-13-19(23)14-20(22-15-17-9-5-3-6-10-17)21(16,2)18-11-7-4-8-12-18/h3-12,16,20,22H,13-15H2,1-2H3/t16-,20?,21-/m1/s1 |
| InChIKey | PWCGURLDXQZXGC-PMYDAVCKSA-N |
| XLogP | 4.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |