About 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene
2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene (PubChem CID 59412972) has the molecular formula C20H24BrO3P
and a molecular weight of 423.29 g/mol. Its IUPAC name is 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene.
Molecular Properties
| Compound Name | 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene |
| PubChem CID | 59412972 |
| Molecular Formula | C20H24BrO3P |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene |
| SMILES | CCOP(=O)(Cc1ccc2c(c1)C(C)(C)c1cc(Br)ccc1-2)OCC |
| InChI | InChI=1S/C20H24BrO3P/c1-5-23-25(22,24-6-2)13-14-7-9-16-17-10-8-15(21)12-19(17)20(3,4)18(16)11-14/h7-12H,5-6,13H2,1-4H3 |
| InChIKey | DOBJIZUCECXKQG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene?
The IUPAC name of 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene (CID 59412972) is 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene.
What is the SMILES notation for 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene?
The canonical SMILES for 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene is CCOP(=O)(Cc1ccc2c(c1)C(C)(C)c1cc(Br)ccc1-2)OCC.
What is the InChIKey of 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene?
The InChIKey is DOBJIZUCECXKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24BrO3P/c1-5-23-25(22,24-6-2)13-14-7-9-16-17-10-8-15(21)12-19(17)20(3,4)18(16)11-14/h7-12H,5-6,13H2,1-4H3.
What are the key properties of 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene?
2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene has a molecular weight of 423.29 g/mol, XLogP of 6.52, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-7-(diethoxyphosphorylmethyl)-9,9-dimethylfluorene is sourced from PubChem (CID 59412972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).