C23H32N5OY- — CID 59414120
(2S)-2-[[2-[benzyl(methyl)amino]pyrimidin-4-yl]amino]-3-cyclohexyl-N-ethylpropanamide;yttrium (PubChem CID 59414120) has the molecular formula C23H32N5OY- and a molecular weight of 483.45 g/mol. Its IUPAC name is (2S)-2-[[2-[benzyl(methyl)amino]pyrimidin-4-yl]amino]-3-cyclohexyl-N-ethylpropanamide;yttrium.
| Compound Name | (2S)-2-[[2-[benzyl(methyl)amino]pyrimidin-4-yl]amino]-3-cyclohexyl-N-ethylpropanamide;yttrium |
|---|---|
| PubChem CID | 59414120 |
| Molecular Formula | C23H32N5OY- |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (2S)-2-[[2-[benzyl(methyl)amino]pyrimidin-4-yl]amino]-3-cyclohexyl-N-ethylpropanamide;yttrium |
| SMILES | C[CH-]NC(=O)[C@H](CC1CCCCC1)Nc1ccnc(N(C)Cc2ccccc2)n1.[Y] |
| InChI | InChI=1S/C23H32N5O.Y/c1-3-24-22(29)20(16-18-10-6-4-7-11-18)26-21-14-15-25-23(27-21)28(2)17-19-12-8-5-9-13-19;/h3,5,8-9,12-15,18,20H,4,6-7,10-11,16-17H2,1-2H3,(H,24,29)(H,25,26,27);/q-1;/t20-;/m0./s1 |
| InChIKey | XHHKPZSKHGMPOL-BDQAORGHSA-N |
| XLogP | 4.16 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|