C23H29N7O2S — CID 59414305
N-[1-(1-ethylsulfonylpiperidin-4-yl)propyl]-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 59414305) has the molecular formula C23H29N7O2S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-[1-(1-ethylsulfonylpiperidin-4-yl)propyl]-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine.
| Compound Name | N-[1-(1-ethylsulfonylpiperidin-4-yl)propyl]-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59414305 |
| Molecular Formula | C23H29N7O2S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[1-(1-ethylsulfonylpiperidin-4-yl)propyl]-5-isocyano-4-(5-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | [C-]#[N+]c1cnc(NC(CC)C2CCN(S(=O)(=O)CC)CC2)nc1-c1c[nH]c2ncc(C)cc12 |
| InChI | InChI=1S/C23H29N7O2S/c1-5-19(16-7-9-30(10-8-16)33(31,32)6-2)28-23-27-14-20(24-4)21(29-23)18-13-26-22-17(18)11-15(3)12-25-22/h11-14,16,19H,5-10H2,1-3H3,(H,25,26)(H,27,28,29) |
| InChIKey | HHCXOBZAPFSHNQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|