C20H24F6N4O3 — CID 59414922
1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-[di(cyclobutyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 59414922) has the molecular formula C20H24F6N4O3 and a molecular weight of 482.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-[di(cyclobutyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-[di(cyclobutyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 59414922 |
| Molecular Formula | C20H24F6N4O3 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-amino-3-[di(cyclobutyl)methyl]-4-oxo-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | Nc1nc2c(c(=O)n1C(C1CCC1)C1CCC1)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C20H24F6N4O3/c21-19(22,23)16(20(24,25)26)33-18(32)29-8-7-12-13(9-29)28-17(27)30(15(12)31)14(10-3-1-4-10)11-5-2-6-11/h10-11,14,16H,1-9H2,(H2,27,28) |
| InChIKey | QENJNSPWXACZBW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |