C17H32N2O — CID 59415452
4,7-ditert-butyl-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-6-one (PubChem CID 59415452) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is 4,7-ditert-butyl-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-6-one.
| Compound Name | 4,7-ditert-butyl-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-6-one |
|---|---|
| PubChem CID | 59415452 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 4,7-ditert-butyl-1,2,3,4,7,8,9,10-octahydropyridazino[1,2-a]diazepin-6-one |
| SMILES | CC(C)(C)C1CCCN2CCCC(C(C)(C)C)N2C1=O |
| InChI | InChI=1S/C17H32N2O/c1-16(2,3)13-9-7-11-18-12-8-10-14(17(4,5)6)19(18)15(13)20/h13-14H,7-12H2,1-6H3 |
| InChIKey | WOZPVUZHTYVZPW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |