C26H25N3O7 — CID 59415569
1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrazolidine-1,3-dicarboxylate (PubChem CID 59415569) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrazolidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrazolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59415569 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3S)-2-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrazolidine-1,3-dicarboxylate |
| SMILES | C=CC[C@@H](C(=O)N1[C@H](C(=O)OC)CCN1C(=O)OCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H25N3O7/c1-3-9-20(28-22(30)18-12-7-8-13-19(18)23(28)31)24(32)29-21(25(33)35-2)14-15-27(29)26(34)36-16-17-10-5-4-6-11-17/h3-8,10-13,20-21H,1,9,14-16H2,2H3/t20-,21-/m0/s1 |
| InChIKey | WUKNAHIOQKLVBZ-SFTDATJTSA-N |
| XLogP | 2.56 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|