C14H10F3N3O2S — CID 59416198
2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 59416198) has the molecular formula C14H10F3N3O2S and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59416198 |
| Molecular Formula | C14H10F3N3O2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2cc[nH]c2[nH]c(=S)n1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H10F3N3O2S/c15-14(16,17)7-22-9-3-1-8(2-4-9)20-12(21)10-5-6-18-11(10)19-13(20)23/h1-6,18H,7H2,(H,19,23) |
| InChIKey | HTDMGJXAJJFUOZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|