C16H10F7N3O4 — CID 59416299
3-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-2-(2,2,2-trifluoroethoxy)-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione (PubChem CID 59416299) has the molecular formula C16H10F7N3O4 and a molecular weight of 441.26 g/mol. Its IUPAC name is 3-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-2-(2,2,2-trifluoroethoxy)-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione.
| Compound Name | 3-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-2-(2,2,2-trifluoroethoxy)-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 59416299 |
| Molecular Formula | C16H10F7N3O4 |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3-[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]-2-(2,2,2-trifluoroethoxy)-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
| SMILES | O=C1Cc2c(nc(OCC(F)(F)F)n(-c3ccc(OCC(F)(F)F)c(F)c3)c2=O)N1 |
| InChI | InChI=1S/C16H10F7N3O4/c17-9-3-7(1-2-10(9)29-5-15(18,19)20)26-13(28)8-4-11(27)24-12(8)25-14(26)30-6-16(21,22)23/h1-3H,4-6H2,(H,24,27) |
| InChIKey | VOCUTWXKMZLZDQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |