C20H22F3N3O5 — CID 59416321
2-[2-(2-ethoxyethoxy)ethoxy]-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 59416321) has the molecular formula C20H22F3N3O5 and a molecular weight of 441.41 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59416321 |
| Molecular Formula | C20H22F3N3O5 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCOCCOCCOc1nc2cc[nH]c2c(=O)n1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O5/c1-2-28-9-10-29-11-12-30-19-25-16-7-8-24-17(16)18(27)26(19)14-3-5-15(6-4-14)31-13-20(21,22)23/h3-8,24H,2,9-13H2,1H3 |
| InChIKey | WARJGVFSHPYFFU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|