C19H20F3N3O3S — CID 59416381
2-(3-ethoxypropylsulfanyl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 59416381) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-(3-ethoxypropylsulfanyl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(3-ethoxypropylsulfanyl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59416381 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(3-ethoxypropylsulfanyl)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCOCCCSc1nc2cc[nH]c2c(=O)n1-c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O3S/c1-2-27-10-3-11-29-18-24-15-8-9-23-16(15)17(26)25(18)13-4-6-14(7-5-13)28-12-19(20,21)22/h4-9,23H,2-3,10-12H2,1H3 |
| InChIKey | YMHCOECMXCTUNP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|