C16H14F3N3O2S — CID 59416442
7-ethyl-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 59416442) has the molecular formula C16H14F3N3O2S and a molecular weight of 369.37 g/mol. Its IUPAC name is 7-ethyl-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 7-ethyl-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 59416442 |
| Molecular Formula | C16H14F3N3O2S |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 7-ethyl-2-sulfanylidene-3-[4-(2,2,2-trifluoroethoxy)phenyl]-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCc1c[nH]c2c(=O)n(-c3ccc(OCC(F)(F)F)cc3)c(=S)[nH]c12 |
| InChI | InChI=1S/C16H14F3N3O2S/c1-2-9-7-20-13-12(9)21-15(25)22(14(13)23)10-3-5-11(6-4-10)24-8-16(17,18)19/h3-7,20H,2,8H2,1H3,(H,21,25) |
| InChIKey | VYEPDRPSHCCTRU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|