About 3-ethyl-2,3-dimethylindole
3-ethyl-2,3-dimethylindole (PubChem CID 594165) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-ethyl-2,3-dimethylindole.
Molecular Properties
| Compound Name | 3-ethyl-2,3-dimethylindole |
| PubChem CID | 594165 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 3-ethyl-2,3-dimethylindole |
| SMILES | CCC1(C)C(C)=Nc2ccccc21 |
| InChI | InChI=1S/C12H15N/c1-4-12(3)9(2)13-11-8-6-5-7-10(11)12/h5-8H,4H2,1-3H3 |
| InChIKey | LVCJOTSREMDVNB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,3-dimethylindole?
The IUPAC name of 3-ethyl-2,3-dimethylindole (CID 594165) is 3-ethyl-2,3-dimethylindole.
What is the SMILES notation for 3-ethyl-2,3-dimethylindole?
The canonical SMILES for 3-ethyl-2,3-dimethylindole is CCC1(C)C(C)=Nc2ccccc21.
What is the InChIKey of 3-ethyl-2,3-dimethylindole?
The InChIKey is LVCJOTSREMDVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-4-12(3)9(2)13-11-8-6-5-7-10(11)12/h5-8H,4H2,1-3H3.
What are the key properties of 3-ethyl-2,3-dimethylindole?
3-ethyl-2,3-dimethylindole has a molecular weight of 173.26 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,3-dimethylindole is sourced from PubChem (CID 594165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).