C20H20N4O5S2 — CID 59416915
N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(5-sulfamoylthiophen-2-yl)buta-1,3-diynyl]benzamide (PubChem CID 59416915) has the molecular formula C20H20N4O5S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(5-sulfamoylthiophen-2-yl)buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(5-sulfamoylthiophen-2-yl)buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59416915 |
| Molecular Formula | C20H20N4O5S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-[4-(5-sulfamoylthiophen-2-yl)buta-1,3-diynyl]benzamide |
| SMILES | CC(C)(N)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(S(N)(=O)=O)s2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H20N4O5S2/c1-20(2,21)17(19(26)24-27)23-18(25)14-9-7-13(8-10-14)5-3-4-6-15-11-12-16(30-15)31(22,28)29/h7-12,17,27H,21H2,1-2H3,(H,23,25)(H,24,26)(H2,22,28,29)/t17-/m1/s1 |
| InChIKey | ZDGBZQLUBJPQDE-QGZVFWFLSA-N |
| XLogP | 0.14 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|