C16H17F3N2O5S — CID 59417371
methyl 3-methyl-2-[[6-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]amino]butanoate (PubChem CID 59417371) has the molecular formula C16H17F3N2O5S and a molecular weight of 406.38 g/mol. Its IUPAC name is methyl 3-methyl-2-[[6-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]amino]butanoate.
| Compound Name | methyl 3-methyl-2-[[6-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]amino]butanoate |
|---|---|
| PubChem CID | 59417371 |
| Molecular Formula | C16H17F3N2O5S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | methyl 3-methyl-2-[[6-(trifluoromethylsulfonyloxy)isoquinolin-3-yl]amino]butanoate |
| SMILES | COC(=O)C(Nc1cc2cc(OS(=O)(=O)C(F)(F)F)ccc2cn1)C(C)C |
| InChI | InChI=1S/C16H17F3N2O5S/c1-9(2)14(15(22)25-3)21-13-7-11-6-12(5-4-10(11)8-20-13)26-27(23,24)16(17,18)19/h4-9,14H,1-3H3,(H,20,21) |
| InChIKey | UCFFBVYDBQEDIJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|