C26H28N2O4 — CID 59417429
methyl (2S,3R)-2-[[4-[(E)-4-[4-[(cyclopropylamino)methyl]phenyl]but-3-en-1-ynyl]benzoyl]amino]-3-hydroxybutanoate (PubChem CID 59417429) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[4-[(E)-4-[4-[(cyclopropylamino)methyl]phenyl]but-3-en-1-ynyl]benzoyl]amino]-3-hydroxybutanoate.
| Compound Name | methyl (2S,3R)-2-[[4-[(E)-4-[4-[(cyclopropylamino)methyl]phenyl]but-3-en-1-ynyl]benzoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 59417429 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl (2S,3R)-2-[[4-[(E)-4-[4-[(cyclopropylamino)methyl]phenyl]but-3-en-1-ynyl]benzoyl]amino]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C#C/C=C/c2ccc(CNC3CC3)cc2)cc1)[C@@H](C)O |
| InChI | InChI=1S/C26H28N2O4/c1-18(29)24(26(31)32-2)28-25(30)22-13-11-20(12-14-22)6-4-3-5-19-7-9-21(10-8-19)17-27-23-15-16-23/h3,5,7-14,18,23-24,27,29H,15-17H2,1-2H3,(H,28,30)/b5-3+/t18-,24+/m1/s1 |
| InChIKey | JGNAGHRAQLISNN-BJVJJHBKSA-N |
| XLogP | 2.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|