C31H30F3N3O6 — CID 59417929
4-[[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-3,4-dihydro-1H-isoquinolin-8-yl]oxy]butanoic acid (PubChem CID 59417929) has the molecular formula C31H30F3N3O6 and a molecular weight of 597.59 g/mol. Its IUPAC name is 4-[[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-3,4-dihydro-1H-isoquinolin-8-yl]oxy]butanoic acid.
| Compound Name | 4-[[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-3,4-dihydro-1H-isoquinolin-8-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 59417929 |
| Molecular Formula | C31H30F3N3O6 |
| Molecular Weight | 597.59 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | 4-[[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-3,4-dihydro-1H-isoquinolin-8-yl]oxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cccc2c1CN(CC(O)(c1cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc13)C(F)(F)F)CC2 |
| InChI | InChI=1S/C31H30F3N3O6/c32-31(33,34)30(40,20-35-14-13-22-8-4-9-28(25(22)18-35)43-15-5-10-29(38)39)26-19-36(17-21-6-2-1-3-7-21)27-16-23(37(41)42)11-12-24(26)27/h1-4,6-9,11-12,16,19,40H,5,10,13-15,17-18,20H2,(H,38,39) |
| InChIKey | PWXLEXZRVLQXOM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 118.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|