C30H25F3N2O6 — CID 59417930
ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate (PubChem CID 59417930) has the molecular formula C30H25F3N2O6 and a molecular weight of 566.53 g/mol. Its IUPAC name is ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate.
| Compound Name | ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate |
|---|---|
| PubChem CID | 59417930 |
| Molecular Formula | C30H25F3N2O6 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC(OCOC)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H25F3N2O6/c1-3-40-28(36)23-11-9-21(10-12-23)15-16-29(30(31,32)33,41-20-39-2)26-19-34(18-22-7-5-4-6-8-22)27-17-24(35(37)38)13-14-25(26)27/h4-14,17,19H,3,18,20H2,1-2H3 |
| InChIKey | HFGHYPOFXTUERU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|