C26H22F3N3O5S — CID 59418057
5-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxylic acid (PubChem CID 59418057) has the molecular formula C26H22F3N3O5S and a molecular weight of 545.54 g/mol. Its IUPAC name is 5-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59418057 |
| Molecular Formula | C26H22F3N3O5S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 5-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)CCN(CC(O)(c1cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc13)C(F)(F)F)C2 |
| InChI | InChI=1S/C26H22F3N3O5S/c27-26(28,29)25(35,15-30-9-8-22-17(13-30)10-23(38-22)24(33)34)20-14-31(12-16-4-2-1-3-5-16)21-11-18(32(36)37)6-7-19(20)21/h1-7,10-11,14,35H,8-9,12-13,15H2,(H,33,34) |
| InChIKey | GKYFJKHKKFXHLE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|