C34H35F4N3O7 — CID 59418190
ethyl 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-[1-[(3-fluorophenyl)methyl]-6-nitroindol-3-yl]-2-hydroxypropyl]piperidin-4-yl]oxyphenyl]acetate (PubChem CID 59418190) has the molecular formula C34H35F4N3O7 and a molecular weight of 673.66 g/mol. Its IUPAC name is ethyl 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-[1-[(3-fluorophenyl)methyl]-6-nitroindol-3-yl]-2-hydroxypropyl]piperidin-4-yl]oxyphenyl]acetate.
| Compound Name | ethyl 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-[1-[(3-fluorophenyl)methyl]-6-nitroindol-3-yl]-2-hydroxypropyl]piperidin-4-yl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 59418190 |
| Molecular Formula | C34H35F4N3O7 |
| Molecular Weight | 673.66 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | ethyl 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-[1-[(3-fluorophenyl)methyl]-6-nitroindol-3-yl]-2-hydroxypropyl]piperidin-4-yl]oxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC2CCN(CC(O)(c3cn(Cc4cccc(F)c4)c4cc([N+](=O)[O-])ccc34)C(F)(F)F)CC2)c(OC)c1 |
| InChI | InChI=1S/C34H35F4N3O7/c1-3-47-32(42)17-22-7-10-30(31(16-22)46-2)48-26-11-13-39(14-12-26)21-33(43,34(36,37)38)28-20-40(19-23-5-4-6-24(35)15-23)29-18-25(41(44)45)8-9-27(28)29/h4-10,15-16,18,20,26,43H,3,11-14,17,19,21H2,1-2H3 |
| InChIKey | SZJSPGNBSYRLSD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|