About 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride
3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride (PubChem CID 59418233) has the molecular formula C8H13FN2O
and a molecular weight of 172.20 g/mol. Its IUPAC name is 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride.
Molecular Properties
| Compound Name | 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride |
| PubChem CID | 59418233 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride |
| SMILES | CN1CC2CCC(C1)N2C(=O)F |
| InChI | InChI=1S/C8H13FN2O/c1-10-4-6-2-3-7(5-10)11(6)8(9)12/h6-7H,2-5H2,1H3 |
| InChIKey | CZMDKZGOLAVMRI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride?
The IUPAC name of 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride (CID 59418233) is 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride.
What is the SMILES notation for 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride?
The canonical SMILES for 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride is CN1CC2CCC(C1)N2C(=O)F.
What is the InChIKey of 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride?
The InChIKey is CZMDKZGOLAVMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2O/c1-10-4-6-2-3-7(5-10)11(6)8(9)12/h6-7H,2-5H2,1H3.
What are the key properties of 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride?
3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride has a molecular weight of 172.20 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,8-diazabicyclo[3.2.1]octane-8-carbonyl fluoride is sourced from PubChem (CID 59418233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).