C9H11NO — CID 59419375
4-methyl-1,3,3a,7a-tetrahydroindol-2-one (PubChem CID 59419375) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-methyl-1,3,3a,7a-tetrahydroindol-2-one.
| Compound Name | 4-methyl-1,3,3a,7a-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 59419375 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-methyl-1,3,3a,7a-tetrahydroindol-2-one |
| SMILES | CC1=CC=CC2NC(=O)CC12 |
| InChI | InChI=1S/C9H11NO/c1-6-3-2-4-8-7(6)5-9(11)10-8/h2-4,7-8H,5H2,1H3,(H,10,11) |
| InChIKey | ZHGXWAVBPFRPEE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |