About methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate
methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate (PubChem CID 59419623) has the molecular formula C25H23FN2O2
and a molecular weight of 402.47 g/mol. Its IUPAC name is methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate |
| PubChem CID | 59419623 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccccc1)c1ccc2c(-c3ccc(F)cc3)ncn2c1 |
| InChI | InChI=1S/C25H23FN2O2/c1-25(2,24(29)30-3)22(17-7-5-4-6-8-17)19-11-14-21-23(27-16-28(21)15-19)18-9-12-20(26)13-10-18/h4-16,22H,1-3H3 |
| InChIKey | XMRKBXGHWIIZPJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate?
The IUPAC name of methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate (CID 59419623) is methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate.
What is the SMILES notation for methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate?
The canonical SMILES for methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate is COC(=O)C(C)(C)C(c1ccccc1)c1ccc2c(-c3ccc(F)cc3)ncn2c1.
What is the InChIKey of methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate?
The InChIKey is XMRKBXGHWIIZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23FN2O2/c1-25(2,24(29)30-3)22(17-7-5-4-6-8-17)19-11-14-21-23(27-16-28(21)15-19)18-9-12-20(26)13-10-18/h4-16,22H,1-3H3.
What are the key properties of methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate?
methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate has a molecular weight of 402.47 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1-(4-fluorophenyl)imidazo[1,5-a]pyridin-6-yl]-2,2-dimethyl-3-phenylpropanoate is sourced from PubChem (CID 59419623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).