C16H14N2O2 — CID 59419625
ethyl 3-phenylimidazo[1,5-a]pyridine-7-carboxylate (PubChem CID 59419625) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is ethyl 3-phenylimidazo[1,5-a]pyridine-7-carboxylate.
| Compound Name | ethyl 3-phenylimidazo[1,5-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 59419625 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethyl 3-phenylimidazo[1,5-a]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1ccn2c(-c3ccccc3)ncc2c1 |
| InChI | InChI=1S/C16H14N2O2/c1-2-20-16(19)13-8-9-18-14(10-13)11-17-15(18)12-6-4-3-5-7-12/h3-11H,2H2,1H3 |
| InChIKey | JWPRAHSNYPRTAI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |