About 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid
3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid (PubChem CID 59419638) has the molecular formula C18H17BrN2O2
and a molecular weight of 373.25 g/mol. Its IUPAC name is 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid |
| PubChem CID | 59419638 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C(c1ccccc1)c1ccc2c(Br)ncn2c1 |
| InChI | InChI=1S/C18H17BrN2O2/c1-18(2,17(22)23)15(12-6-4-3-5-7-12)13-8-9-14-16(19)20-11-21(14)10-13/h3-11,15H,1-2H3,(H,22,23) |
| InChIKey | OBOGULBCVUEXMN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid?
The IUPAC name of 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid (CID 59419638) is 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid.
What is the SMILES notation for 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid?
The canonical SMILES for 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid is CC(C)(C(=O)O)C(c1ccccc1)c1ccc2c(Br)ncn2c1.
What is the InChIKey of 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid?
The InChIKey is OBOGULBCVUEXMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2O2/c1-18(2,17(22)23)15(12-6-4-3-5-7-12)13-8-9-14-16(19)20-11-21(14)10-13/h3-11,15H,1-2H3,(H,22,23).
What are the key properties of 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid?
3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid has a molecular weight of 373.25 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-bromoimidazo[1,5-a]pyridin-6-yl)-2,2-dimethyl-3-phenylpropanoic acid is sourced from PubChem (CID 59419638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).