C29H40O4S — CID 59419948
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-methylphenyl)sulfanylacetate (PubChem CID 59419948) has the molecular formula C29H40O4S and a molecular weight of 484.70 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-methylphenyl)sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 59419948 |
| Molecular Formula | C29H40O4S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-methylphenyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(C)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H40O4S/c1-7-27(5)16-23(33-24(31)17-34-21-10-8-9-18(2)15-21)28(6)19(3)11-13-29(20(4)26(27)32)14-12-22(30)25(28)29/h7-10,15,19-20,23,25-26,32H,1,11-14,16-17H2,2-6H3/t19?,20-,23+,25?,26-,27+,28-,29?/m0/s1 |
| InChIKey | PTJJDYVXPOOKAM-ZKJDDWSZSA-N |
| XLogP | 5.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|