C28H37FO4S — CID 59419956
[(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-fluorophenyl)sulfanylacetate (PubChem CID 59419956) has the molecular formula C28H37FO4S and a molecular weight of 488.67 g/mol. Its IUPAC name is [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-fluorophenyl)sulfanylacetate.
| Compound Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 59419956 |
| Molecular Formula | C28H37FO4S |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [(2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-(3-fluorophenyl)sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(F)c2)[C@]2(C)C(C)CCC3(CCC(=O)C32)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C28H37FO4S/c1-6-26(4)15-22(33-23(31)16-34-20-9-7-8-19(29)14-20)27(5)17(2)10-12-28(18(3)25(26)32)13-11-21(30)24(27)28/h6-9,14,17-18,22,24-25,32H,1,10-13,15-16H2,2-5H3/t17?,18-,22+,24?,25-,26+,27-,28?/m0/s1 |
| InChIKey | PHQCMSRRDUXQOZ-RYZCGXKMSA-N |
| XLogP | 5.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|