About (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one
(Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one (PubChem CID 59419979) has the molecular formula C26H48O2
and a molecular weight of 392.67 g/mol. Its IUPAC name is (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one.
Molecular Properties
| Compound Name | (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one |
| PubChem CID | 59419979 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)CCC1OCC(C)C1C |
| InChI | InChI=1S/C26H48O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(27)20-21-26-24(3)23(2)22-28-26/h11-12,23-24,26H,4-10,13-22H2,1-3H3/b12-11- |
| InChIKey | ZJYREKTWMSHOGF-QXMHVHEDSA-N |
| XLogP | 8.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one?
The IUPAC name of (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one (CID 59419979) is (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one.
What is the SMILES notation for (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one?
The canonical SMILES for (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one is CCCCCCCC/C=C\CCCCCCCC(=O)CCC1OCC(C)C1C.
What is the InChIKey of (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one?
The InChIKey is ZJYREKTWMSHOGF-QXMHVHEDSA-N. The full InChI is InChI=1S/C26H48O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(27)20-21-26-24(3)23(2)22-28-26/h11-12,23-24,26H,4-10,13-22H2,1-3H3/b12-11-.
What are the key properties of (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one?
(Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one has a molecular weight of 392.67 g/mol, XLogP of 8.04, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(3,4-dimethyloxolan-2-yl)icos-11-en-3-one is sourced from PubChem (CID 59419979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).