C23H28N6O3 — CID 59420169
[4-[1-[(Z)-3-amino-1-cyclopentyl-3-oxoprop-1-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59420169) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is [4-[1-[(Z)-3-amino-1-cyclopentyl-3-oxoprop-1-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[1-[(Z)-3-amino-1-cyclopentyl-3-oxoprop-1-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59420169 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [4-[1-[(Z)-3-amino-1-cyclopentyl-3-oxoprop-1-enyl]pyrazol-4-yl]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1ccc2c(-c3cnn(/C(=C\C(N)=O)C4CCCC4)c3)ncnc21 |
| InChI | InChI=1S/C23H28N6O3/c1-23(2,3)22(31)32-14-28-9-8-17-20(25-13-26-21(17)28)16-11-27-29(12-16)18(10-19(24)30)15-6-4-5-7-15/h8-13,15H,4-7,14H2,1-3H3,(H2,24,30)/b18-10- |
| InChIKey | RKRISTQTYQDPGI-ZDLGFXPLSA-N |
| XLogP | 3.36 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|