About (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate
(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate (PubChem CID 59420178) has the molecular formula C13H17N3O2
and a molecular weight of 247.30 g/mol. Its IUPAC name is (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 59420178 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate |
| SMILES | Cc1ncnc2c1ccn2COC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H17N3O2/c1-9-10-5-6-16(11(10)15-7-14-9)8-18-12(17)13(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | QWVUQDHCFZGJGE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate (CID 59420178) is (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate is Cc1ncnc2c1ccn2COC(=O)C(C)(C)C.
What is the InChIKey of (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate?
The InChIKey is QWVUQDHCFZGJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2/c1-9-10-5-6-16(11(10)15-7-14-9)8-18-12(17)13(2,3)4/h5-7H,8H2,1-4H3.
What are the key properties of (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate?
(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate has a molecular weight of 247.30 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpyrrolo[2,3-d]pyrimidin-7-yl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 59420178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).