About 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane
2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane (PubChem CID 59420313) has the molecular formula C26H26BNO5
and a molecular weight of 443.31 g/mol. Its IUPAC name is 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane |
| PubChem CID | 59420313 |
| Molecular Formula | C26H26BNO5 |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc(B3OCC(c4ccccc4)O3)c(COC(C)OCC)c2)cc1 |
| InChI | InChI=1S/C26H26BNO5/c1-4-29-19(2)30-17-21-16-24(32-23-12-10-22(28-3)11-13-23)14-15-25(21)27-31-18-26(33-27)20-8-6-5-7-9-20/h5-16,19,26H,4,17-18H2,1-2H3 |
| InChIKey | AZYAAXSMRSRYKS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane?
The IUPAC name of 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane (CID 59420313) is 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane.
What is the SMILES notation for 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane?
The canonical SMILES for 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane is [C-]#[N+]c1ccc(Oc2ccc(B3OCC(c4ccccc4)O3)c(COC(C)OCC)c2)cc1.
What is the InChIKey of 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane?
The InChIKey is AZYAAXSMRSRYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26BNO5/c1-4-29-19(2)30-17-21-16-24(32-23-12-10-22(28-3)11-13-23)14-15-25(21)27-31-18-26(33-27)20-8-6-5-7-9-20/h5-16,19,26H,4,17-18H2,1-2H3.
What are the key properties of 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane?
2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane has a molecular weight of 443.31 g/mol, XLogP of 5.41, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-ethoxyethoxymethyl)-4-(4-isocyanophenoxy)phenyl]-4-phenyl-1,3,2-dioxaborolane is sourced from PubChem (CID 59420313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).