C23H27N3O2 — CID 59420452
N-[4-[2-(4-aminophenyl)ethyl]phenyl]-2-(5-tert-butyl-1,2-oxazol-3-yl)acetamide (PubChem CID 59420452) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-[4-[2-(4-aminophenyl)ethyl]phenyl]-2-(5-tert-butyl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-[4-[2-(4-aminophenyl)ethyl]phenyl]-2-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 59420452 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[4-[2-(4-aminophenyl)ethyl]phenyl]-2-(5-tert-butyl-1,2-oxazol-3-yl)acetamide |
| SMILES | CC(C)(C)c1cc(CC(=O)Nc2ccc(CCc3ccc(N)cc3)cc2)no1 |
| InChI | InChI=1S/C23H27N3O2/c1-23(2,3)21-14-20(26-28-21)15-22(27)25-19-12-8-17(9-13-19)5-4-16-6-10-18(24)11-7-16/h6-14H,4-5,15,24H2,1-3H3,(H,25,27) |
| InChIKey | RNYZARRQLQAJKY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|