C21H23N5O5S — CID 59421098
N-hydroxy-2-[(3R,4S)-3-methoxy-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide (PubChem CID 59421098) has the molecular formula C21H23N5O5S and a molecular weight of 457.51 g/mol. Its IUPAC name is N-hydroxy-2-[(3R,4S)-3-methoxy-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[(3R,4S)-3-methoxy-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59421098 |
| Molecular Formula | C21H23N5O5S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | N-hydroxy-2-[(3R,4S)-3-methoxy-4-(naphthalen-2-ylsulfonylamino)piperidin-1-yl]pyrimidine-5-carboxamide |
| SMILES | CO[C@@H]1CN(c2ncc(C(=O)NO)cn2)CC[C@@H]1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H23N5O5S/c1-31-19-13-26(21-22-11-16(12-23-21)20(27)24-28)9-8-18(19)25-32(29,30)17-7-6-14-4-2-3-5-15(14)10-17/h2-7,10-12,18-19,25,28H,8-9,13H2,1H3,(H,24,27)/t18-,19+/m0/s1 |
| InChIKey | NRJFROLNSYBAPS-RBUKOAKNSA-N |
| XLogP | 1.32 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|